CAS 102308-43-0

4-BROMO-2-BENZOFURAN-1(3H)-ONE

Description:

4-Bromo-2-benzofuran-1(3H)-one, with the CAS number 102308-43-0, is a chemical compound characterized by its unique structure, which includes a benzofuran moiety substituted with a bromine atom and a carbonyl group. This compound typically appears as a solid and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The benzofuran structure contributes to its aromatic properties, which can influence its solubility and stability in different solvents. Additionally, compounds of this class may exhibit biological activity, making them of interest in pharmacological research. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks. Overall, 4-bromo-2-benzofuran-1(3H)-one represents a versatile building block in the field of organic chemistry.

Formula: C₈H₅BrO₂

InChI: InChI=1/C8H5BrO2/c9-7-3-1-2-5-6(7)4-11-8(5)10/h1-3H,4H2

SMILES: c1cc2c(COC2=O)c(c1)Br

Synonyms:

• 4-Bromophthalide
• 4-Bromo-3H-Isobenzofuran-1-One

1(3H)-Isobenzofuranone, 4-bromo-

CAS: 102308-43-0

Formula: C₈H₅BrO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 213.0281

Ref: IN-DA000769

4-Bromophthalide

CAS: 102308-43-0

4-Bromophthalide

Purity: 97%

Color and Shape: Solid

Molecular weight: 213.03g/mol

Ref: 54-OR301006

4-Bromophthalide

CAS: 102308-43-0

4-Bromophthalide is a chemical compound that has a wide range of uses in research and industry. It reacts with organic compounds to form new substances, which can then be used as building blocks for more complex molecules. 4-Bromophthalide is an intermediate in the synthesis of pharmaceuticals such as pyrazinamide and is also useful as a starting material for the production of other chemicals such as dyes, pesticides, and pharmaceuticals.

Formula: C₈H₅BrO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 213.03 g/mol

Ref: 3D-FB70584

4-Bromo-3H-isobenzofuran-1-one

CAS: 102308-43-0

Formula: C₈H₅BrO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 213.03

Ref: 10-F043274