CAS 102308-43-0
:4-BROMO-2-BENZOFURAN-1(3H)-ONE
Description:
4-Bromo-2-benzofuran-1(3H)-one, with the CAS number 102308-43-0, is a chemical compound characterized by its unique structure, which includes a benzofuran moiety substituted with a bromine atom and a carbonyl group. This compound typically appears as a solid and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The benzofuran structure contributes to its aromatic properties, which can influence its solubility and stability in different solvents. Additionally, compounds of this class may exhibit biological activity, making them of interest in pharmacological research. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks. Overall, 4-bromo-2-benzofuran-1(3H)-one represents a versatile building block in the field of organic chemistry.
Formula:C8H5BrO2
InChI:InChI=1/C8H5BrO2/c9-7-3-1-2-5-6(7)4-11-8(5)10/h1-3H,4H2
SMILES:c1cc2c(COC2=O)c(c1)Br
Synonyms:- 4-Bromophthalide
- 4-Bromo-3H-Isobenzofuran-1-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromophthalide
CAS:4-BromophthalideFormula:C8H5BrO2Purity:97%Color and Shape:SolidMolecular weight:213.02811(3H)-Isobenzofuranone, 4-bromo-
CAS:Formula:C8H5BrO2Purity:98%Color and Shape:SolidMolecular weight:213.0281Ref: IN-DA000769
100gTo inquire250gTo inquire250mg31.00€1g63.00€5g110.00€10g167.00€25g237.00€50g555.00€4-Bromophthalide
CAS:4-Bromophthalide is a chemical compound that has a wide range of uses in research and industry. It reacts with organic compounds to form new substances, which can then be used as building blocks for more complex molecules. 4-Bromophthalide is an intermediate in the synthesis of pharmaceuticals such as pyrazinamide and is also useful as a starting material for the production of other chemicals such as dyes, pesticides, and pharmaceuticals.Formula:C8H5BrO2Purity:Min. 95%Color and Shape:PowderMolecular weight:213.03 g/mol4-Bromo-3H-isobenzofuran-1-one
CAS:Formula:C8H5BrO2Purity:96%Color and Shape:SolidMolecular weight:213.03




