CymitQuimica logo

CAS 1023277-38-4

:

4-(2-Piperidinyl)benzenamine

Description:
4-(2-Piperidinyl)benzenamine, also known as 4-(2-piperidinyl)aniline, is an organic compound characterized by the presence of a piperidine ring attached to a benzeneamine structure. This compound features a piperidine moiety, which is a six-membered saturated nitrogen-containing ring, contributing to its basicity and potential for forming hydrogen bonds. The aniline part of the molecule indicates the presence of an amino group (-NH2) directly bonded to a benzene ring, which can participate in various chemical reactions, including electrophilic substitutions and coupling reactions. The compound is likely to exhibit moderate solubility in polar solvents due to the presence of the amino group, while its hydrophobic benzene ring may enhance its interaction with non-polar environments. Additionally, 4-(2-Piperidinyl)benzenamine may possess biological activity, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is studied.
Formula:C11H16N2
InChI:InChI=1S/C11H16N2/c12-10-6-4-9(5-7-10)11-3-1-2-8-13-11/h4-7,11,13H,1-3,8,12H2
InChI key:InChIKey=KPGZVNSUMRWAHL-UHFFFAOYSA-N
SMILES:NC1=CC=C(C=C1)C2CCCCN2
Synonyms:
  • Benzenamine, 4-(2-piperidinyl)-
  • 4-(2-Piperidinyl)benzenamine
Found 1 products.