CymitQuimica logo

CAS 102340-67-0

:

Quinonoid-(6R)-dihydro-L-biopterin Hydrochloride

Description:
Quinonoid-(6R)-dihydro-L-biopterin hydrochloride is a chemical compound that belongs to the class of pteridines, which are bicyclic compounds containing a pyrimidine and a pyrazine ring. This substance is a derivative of biopterin, an essential cofactor involved in the biosynthesis of neurotransmitters such as serotonin, dopamine, and norepinephrine. The "6R" designation indicates the specific stereochemistry at the 6-position of the pteridine ring, which is crucial for its biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in biological and pharmaceutical applications. Quinonoid-(6R)-dihydro-L-biopterin is known for its role in various enzymatic reactions, particularly those involving aromatic amino acid hydroxylation. Its properties include being a potent antioxidant and a participant in redox reactions, which are vital for cellular metabolism. The compound is of interest in research related to neurological disorders and metabolic pathways, given its involvement in neurotransmitter synthesis and potential therapeutic applications.
Formula:C9H14ClN5O3
InChI:InChI=1S/C9H13N5O3.ClH/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7;/h3-4,6,15-16H,2H2,1H3,(H3,10,11,13,14,17);1H/t3-,4+,6-;/m0./s1
InChI key:SWHYJSMRUIOMKW-ZUOBHZEMSA-N
SMILES:C[C@@H]([C@@H]([C@H]1CN=C2C(=N1)C(=O)NC(=N2)N)O)O.Cl
Synonyms:
  • SWHYJSMRUIOMKW-ZUOBHZEMSA-N
  • Quinonoid-(6R)-dihydro-L-biopterin Hydrochloride
  • [6R-[6R*(1R*,2S*)]]-2-Amino-6-(1,2-dihydroxypropyl)-6,7-dihydro-4(1H)-pteridinone monohydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.