CymitQuimica logo

CAS 10236-14-3

:

Triethyl 4-phosphonocrotonate

Description:
Triethyl 4-phosphonocrotonate is an organophosphorus compound characterized by its phosphonate functional group and a crotonate moiety. It typically appears as a colorless to pale yellow liquid and is soluble in organic solvents such as ethanol and ether. The compound is known for its reactivity, particularly in nucleophilic substitution reactions, due to the presence of the phosphonate group, which can act as a leaving group. Triethyl 4-phosphonocrotonate is often utilized in organic synthesis, particularly in the formation of various phosphonates and as an intermediate in the synthesis of biologically active compounds. Its structure allows for the potential formation of various derivatives, making it a valuable building block in medicinal chemistry. Additionally, it may exhibit biological activity, although specific applications and effects can vary. As with many organophosphorus compounds, handling should be done with care due to potential toxicity and environmental concerns. Proper safety protocols should be followed when working with this substance in laboratory settings.
Formula:C10H19O5P
InChI:InChI=1/C10H19O5P/c1-5-9(10(11)13-6-2)16(12,14-7-3)15-8-4/h5H,6-8H2,1-4H3/b9-5+
InChI key:LXLODBXSCRTXFG-BQYQJAHWSA-N
SMILES:CCOC(=O)/C=C/CP(=O)(OCC)OCC
Synonyms:
  • 4-Phosphonocrotonic acid triethyl ester~Triethyl trans-4-phosphono-2-butenoate
  • ethyl (2E)-4-(diethoxyphosphoryl)but-2-enoate
  • ethyl (2E)-2-(diethoxyphosphoryl)but-2-enoate
Found 4 products.