
CAS 10236-58-5
:L-Selenocysteine
Description:
L-Selenocysteine, with the CAS number 10236-58-5, is a naturally occurring amino acid that is recognized as the 21st amino acid in the genetic code. It is structurally similar to cysteine, with the key difference being the presence of selenium in place of the sulfur atom. This substitution imparts unique biochemical properties to L-selenocysteine, making it essential for the function of various selenoproteins, which play critical roles in antioxidant defense, thyroid hormone metabolism, and redox regulation. L-Selenocysteine is typically incorporated into proteins via a specific tRNA and is encoded by the UGA codon, which usually signals termination in protein synthesis. The compound is characterized by its polar nature, allowing it to participate in various biochemical reactions, including the formation of disulfide bonds and interactions with metal ions. Its antioxidant properties are particularly significant, as it contributes to the activity of enzymes like glutathione peroxidase, which protects cells from oxidative damage. Overall, L-selenocysteine is vital for numerous physiological processes and is of interest in nutritional and biomedical research.
Formula:C3H7NO2Se
InChI:InChI=1S/C3H7NO2Se/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1
InChI key:InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N
SMILES:[C@@H](C(O)=O)(C[SeH])N
Synonyms:- 2: PN: CN110483619 PAGE: 2 claimed sequence
- L-Alanine, 3-selenyl-
- 3-Selenyl-L-alanine
- Seleno-L-cysteine
- L-Selenocysteine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ref: IN-DA000798
25mgTo inquire50mgTo inquire100mgTo inquire250mgTo inquire500mgTo inquire1mg133.00€2mg197.00€5mg253.00€10mg603.00€Selenocysteine
CAS:Selenocysteine is considered to be the 21st amino acid in ribosome-mediated protein synthesis.Cost-effective and quality-assured.Formula:C3H7NO2SePurity:98%Color and Shape:SolidMolecular weight:168.053 Selenylalanine
CAS:Please enquire for more information about 3 Selenylalanine including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C3H6NO2SePurity:Min. 95%Molecular weight:167.06 g/molSelenocysteine
CAS:(R)-2-Amino-3-hydroselenopropanoic acidFormula:C3H7NO2SePurity:95%Molecular weight:168.05





