CymitQuimica logo

CAS 1023674-80-7

:

9-(3-bromophenyl)-10-phenylanthracene

Description:
9-(3-Bromophenyl)-10-phenylanthracene is an organic compound characterized by its polycyclic aromatic structure, which consists of an anthracene core substituted with a bromophenyl group at the 9-position and a phenyl group at the 10-position. This compound typically exhibits strong fluorescence due to its extended π-conjugation, making it of interest in organic electronics and photonics. Its molecular structure contributes to its potential applications in organic light-emitting diodes (OLEDs) and as a fluorescent probe in various chemical and biological systems. The presence of the bromine atom introduces additional properties, such as increased reactivity and the potential for further functionalization. The compound is likely to be insoluble in water but may dissolve in organic solvents, which is common for many aromatic compounds. Safety data should be consulted for handling, as brominated compounds can pose health risks. Overall, 9-(3-bromophenyl)-10-phenylanthracene represents a significant compound in the field of materials science and organic chemistry.
Formula:C26H17Br
InChI:InChI=1S/C26H17Br/c27-20-12-8-11-19(17-20)26-23-15-6-4-13-21(23)25(18-9-2-1-3-10-18)22-14-5-7-16-24(22)26/h1-17H
InChI key:KHPNWZVLPLJEHH-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=CC=CC=C42)C5=CC(=CC=C5)Br
Found 5 products.