CAS 102368-13-8
:1,1'-thiocarbonyldi-2(1H)-pyridone
Description:
1,1'-Thiocarbonyldi-2(1H)-pyridone, identified by its CAS number 102368-13-8, is a chemical compound that features a thiocarbonyl functional group and is derived from pyridone. This compound typically exhibits a solid state at room temperature and is characterized by its unique structural properties, which include the presence of two pyridone rings linked by a thiocarbonyl group. It is known for its potential applications in various fields, including medicinal chemistry and materials science, due to its ability to form coordination complexes and its reactivity towards nucleophiles. The compound may also display interesting biological activities, making it a subject of research in pharmacology. Its solubility can vary depending on the solvent, and it may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used to confirm its structure. Overall, 1,1'-thiocarbonyldi-2(1H)-pyridone is a compound of interest for its chemical properties and potential applications.
Formula:C11H8N2O2S
InChI:InChI=1/C11H8N2O2S/c14-9-5-1-3-7-12(9)11(16)13-8-4-2-6-10(13)15/h1-8H
SMILES:c1ccn(c(=O)c1)C(=S)n1ccccc1=O
Synonyms:- 1,1'-carbonothioyldipyridin-2(1H)-one
- 1,1'-thiocarbonyldipyridin-2(1H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,1'-Thiocarbonyldi-2(1H)-pyridone, 95%
CAS:1,1'-Thiocarbonyldi-2(1H)-pyridone is used in the preparation of thio-analogs of thioureas, sulforaphane and 2-furan-2-yl-3-hydroxy-6-isothiocyanato-chromen-4-one. It is involved in the preparation of norbiotinamine and its reactive derivatives such as isothiocyanates. This Thermo Scientific Chemica
Formula:C11H8N2O2SPurity:95%Color and Shape:Orange to red, PowderMolecular weight:232.262(1H)-Pyridinone, 1,1'-carbonothioylbis-
CAS:Formula:C11H8N2O2SPurity:96%Color and Shape:SolidMolecular weight:232.2584Ref: IN-DA0007AH
1g24.00€5g37.00€10g55.00€25g101.00€50g139.00€100g175.00€250g355.00€500gTo inquire250mg24.00€1,1'-Thiocarbonyldi-2(1H)-pyridone
CAS:1,1'-Thiocarbonyldi-2(1H)-pyridonePurity:98%Molecular weight:232.26g/mol1,1'-Thiocarbonyldi-2(1H)-pyridone
CAS:Formula:C11H8N2O2SPurity:>98.0%(HPLC)(N)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:232.261,1'-Thiocarbonyldi-2(1H)-pyridone
CAS:1,1'-Thiocarbonyldi-2(1H)-pyridonePurity:98%Molecular weight:232.26g/mol1,1′-Thiocarbonyldi-2(1H)-pyridone
CAS:Formula:C11H8N2O2SPurity:95%Color and Shape:Chunks,Crystalline PowderMolecular weight:232.26




