CymitQuimica logo

CAS 102368-13-8

:

1,1'-thiocarbonyldi-2(1H)-pyridone

Description:
1,1'-Thiocarbonyldi-2(1H)-pyridone, identified by its CAS number 102368-13-8, is a chemical compound that features a thiocarbonyl functional group and is derived from pyridone. This compound typically exhibits a solid state at room temperature and is characterized by its unique structural properties, which include the presence of two pyridone rings linked by a thiocarbonyl group. It is known for its potential applications in various fields, including medicinal chemistry and materials science, due to its ability to form coordination complexes and its reactivity towards nucleophiles. The compound may also display interesting biological activities, making it a subject of research in pharmacology. Its solubility can vary depending on the solvent, and it may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used to confirm its structure. Overall, 1,1'-thiocarbonyldi-2(1H)-pyridone is a compound of interest for its chemical properties and potential applications.
Formula:C11H8N2O2S
InChI:InChI=1/C11H8N2O2S/c14-9-5-1-3-7-12(9)11(16)13-8-4-2-6-10(13)15/h1-8H
InChI key:KXMMNJQMGILZDB-UHFFFAOYSA-N
SMILES:c1ccn(c(=O)c1)C(=S)n1ccccc1=O
Synonyms:
  • 1,1'-carbonothioyldipyridin-2(1H)-one
  • 1,1'-thiocarbonyldipyridin-2(1H)-one
Found 7 products.