CymitQuimica logo

CAS 102389-90-2

:

3,4-Pyrrolidinedicarboxylic acid, 1-methyl-, dimethyl ester, cis-

Description:
3,4-Pyrrolidinedicarboxylic acid, 1-methyl-, dimethyl ester, cis- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features two carboxylic acid groups that are esterified with methyl groups, contributing to its dimethyl ester classification. The "cis" designation indicates the spatial arrangement of substituents around the ring, which can influence its reactivity and interactions. Typically, such compounds exhibit properties like solubility in polar solvents due to the presence of the ester functional groups, and they may participate in various chemical reactions, including hydrolysis and esterification. The presence of the nitrogen atom in the ring can also impart basicity and potential for coordination with metal ions. This compound may have applications in organic synthesis, pharmaceuticals, or as intermediates in chemical manufacturing, although specific applications would depend on further research and development. Safety data and handling precautions should be consulted due to the potential reactivity of the functional groups present.
Formula:C9H15NO4
InChI:InChI=1S/C9H15NO4/c1-10-4-6(8(11)13-2)7(5-10)9(12)14-3/h6-7H,4-5H2,1-3H3/t6-,7+
InChI key:PFWNGDGNDOSZPD-KNVOCYPGSA-N
SMILES:CN1C[C@H]([C@H](C1)C(=O)OC)C(=O)OC
Found 3 products.