CymitQuimica logo

CAS 102391-98-0

:

Piperazine, 1-(4-fluorobenzoyl)-

Description:
Piperazine, 1-(4-fluorobenzoyl)- is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic structure containing two nitrogen atoms. The compound features a 4-fluorobenzoyl group, indicating the presence of a fluorine atom on the para position of a benzene ring that is attached to the piperazine. This substitution can influence the compound's biological activity and solubility. Piperazine derivatives are often studied for their pharmacological properties, including potential applications in the treatment of various conditions such as anxiety and depression. The presence of the fluorine atom may enhance lipophilicity and metabolic stability. The compound is typically a solid at room temperature and may exhibit moderate to high solubility in organic solvents. Safety data should be consulted for handling and exposure risks, as with any chemical substance. Overall, Piperazine, 1-(4-fluorobenzoyl)- represents a class of compounds with potential therapeutic applications, warranting further investigation into its properties and effects.
Formula:C11H13FN2O
InChI:InChI=1S/C11H13FN2O/c12-10-3-1-9(2-4-10)11(15)14-7-5-13-6-8-14/h1-4,13H,5-8H2
InChI key:OITKVXMAEXNRRK-UHFFFAOYSA-N
SMILES:C1CN(CCN1)C(=O)C2=CC=C(C=C2)F
Found 2 products.