CymitQuimica logo

CAS 102392-83-6

:

pyrrolidine-1-carboximidamide hydroiodide

Description:
Pyrrolidine-1-carboximidamide hydroiodide is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a carboximidamide functional group. This compound is typically encountered as a hydroiodide salt, which enhances its solubility in polar solvents. Pyrrolidine derivatives are known for their applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to act as building blocks or intermediates in organic synthesis. The presence of the carboximidamide group suggests potential reactivity, including the ability to form hydrogen bonds, which can influence its biological activity and interactions with other molecules. Additionally, the hydroiodide form indicates that it can participate in ionic interactions, which may affect its stability and solubility. Overall, pyrrolidine-1-carboximidamide hydroiodide is of interest in various fields, including organic synthesis and drug development, due to its structural features and potential reactivity.
Formula:C5H12IN3
InChI:InChI=1/C5H11N3.HI/c6-5(7)8-3-1-2-4-8;/h1-4H2,(H3,6,7);1H
InChI key:XPASGQSDLPDWNV-UHFFFAOYSA-N
SMILES:C1CCN(C1)C(=N)N.I
Synonyms:
  • Pyrrolidine-1-Carboxamidine Hydroiodide
Found 2 products.