CymitQuimica logo

CAS 1024-30-2

:

4-[(4-nitrophenyl)sulfonyl]morpholine

Description:
4-[(4-Nitrophenyl)sulfonyl]morpholine, with the CAS number 1024-30-2, is an organic compound characterized by its morpholine structure, which is a six-membered ring containing both nitrogen and oxygen atoms. This compound features a sulfonyl group attached to a para-nitrophenyl moiety, contributing to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the nitro group typically enhances the compound's electrophilic properties, making it useful in nucleophilic substitution reactions. Additionally, the sulfonyl group can act as a leaving group in various chemical transformations. The compound is generally soluble in polar organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Due to its functional groups, it may exhibit biological activity, making it a candidate for further research in medicinal chemistry. Safety data should be consulted for handling and storage, as compounds with nitro and sulfonyl groups can pose health risks.
Formula:C10H12N2O5S
InChI:InChI=1/C10H12N2O5S/c13-12(14)9-1-3-10(4-2-9)18(15,16)11-5-7-17-8-6-11/h1-4H,5-8H2
InChI key:ORGHDHBPWCKATA-UHFFFAOYSA-N
SMILES:c1cc(ccc1N(=O)=O)S(=O)(=O)N1CCOCC1
Found 3 products.