CymitQuimica logo

CAS 1024-38-0

:

Benzenesulfonamide, N-(2-bromophenyl)-4-methyl-

Description:
Benzenesulfonamide, N-(2-bromophenyl)-4-methyl-, with the CAS number 1024-38-0, is an organic compound characterized by the presence of a sulfonamide functional group attached to a benzene ring. This compound features a bromine atom substituted at the 2-position of the phenyl group and a methyl group at the 4-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the sulfonamide group, which can engage in hydrogen bonding. The presence of the bromine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, compounds of this class are often studied for their biological activity, as sulfonamides have been historically significant in medicinal chemistry, particularly as antibacterial agents. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly.
Formula:C13H12BrNO2S
InChI:InChI=1S/C13H12BrNO2S/c1-10-6-8-11(9-7-10)18(16,17)15-13-5-3-2-4-12(13)14/h2-9,15H,1H3
InChI key:NAEOKZYYHWFPCK-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2Br
Found 3 products.