CymitQuimica logo

CAS 1024-94-8

:

3,3'-DINITRO-2,2'-DIPYRIDYL

Description:
3,3'-Dinitro-2,2'-dipyridyl, with the CAS number 1024-94-8, is a chemical compound characterized by its two pyridine rings that are substituted at the 3-position with nitro groups. This compound is typically a yellow crystalline solid and is known for its stability under normal conditions. It exhibits strong electron-withdrawing properties due to the presence of nitro groups, which can influence its reactivity and interactions with other chemical species. 3,3'-Dinitro-2,2'-dipyridyl is often used in various applications, including as a ligand in coordination chemistry and as a reagent in organic synthesis. Its properties make it useful in the study of metal complexes and in the development of materials with specific electronic characteristics. Additionally, due to the presence of nitro groups, it may exhibit explosive properties under certain conditions, necessitating careful handling and storage. Overall, this compound is of interest in both academic research and industrial applications due to its unique structural features and reactivity.
Formula:C10H6N4O4
InChI:InChI=1S/C10H6N4O4/c15-13(16)7-3-1-5-11-9(7)10-8(14(17)18)4-2-6-12-10/h1-6H
InChI key:PQSBMZFINXSHDM-UHFFFAOYSA-N
SMILES:C1=CC(=C(N=C1)C2=C(C=CC=N2)[N+](=O)[O-])[N+](=O)[O-]
Found 3 products.