CymitQuimica logo

CAS 102405-32-3

:

Benzene, 1-(bromomethyl)-3-(1,1-dimethylethyl)-

Description:
Benzene, 1-(bromomethyl)-3-(1,1-dimethylethyl)-, also known by its CAS number 102405-32-3, is an organic compound characterized by a benzene ring substituted with a bromomethyl group and a tert-butyl group. This compound features a bromine atom attached to a carbon chain that is further connected to a tert-butyl group, which consists of a central carbon atom bonded to three methyl groups. The presence of the bromomethyl group introduces reactivity, making it a potential intermediate in various organic synthesis reactions, particularly in nucleophilic substitution reactions. The tert-butyl group contributes to the compound's steric bulk, influencing its reactivity and physical properties. Typically, compounds of this nature are non-polar and exhibit low solubility in water, while being soluble in organic solvents. Additionally, due to the presence of the bromine atom, the compound may exhibit some degree of toxicity and environmental persistence, necessitating careful handling and disposal. Overall, this compound is of interest in synthetic organic chemistry and may have applications in the development of pharmaceuticals or agrochemicals.
Formula:C11H15Br
InChI:InChI=1S/C11H15Br/c1-11(2,3)10-6-4-5-9(7-10)8-12/h4-7H,8H2,1-3H3
InChI key:PJQAWFRZGVFIOK-UHFFFAOYSA-N
SMILES:CC(C)(C)C1=CC=CC(=C1)CBr
Found 3 products.