CAS 102408-28-6: 1-Methyl-2-methylaminoimidazo[4,5-F]quinoline
Description:1-Methyl-2-methylaminoimidazo[4,5-F]quinoline is a heterocyclic organic compound characterized by its complex structure, which includes both imidazole and quinoline moieties. This compound typically exhibits a fused ring system, contributing to its aromatic properties and potential biological activity. It is known for its role in various chemical and pharmaceutical applications, particularly in the field of medicinal chemistry, where it may serve as a scaffold for drug development. The presence of the methyl and methylamino groups can influence its solubility, reactivity, and interaction with biological targets. Additionally, compounds of this type may exhibit fluorescence properties, making them useful in analytical chemistry and imaging applications. Safety and handling considerations are essential, as with many organic compounds, due to potential toxicity or reactivity. Overall, 1-Methyl-2-methylaminoimidazo[4,5-F]quinoline represents a significant class of compounds with diverse applications in research and industry.
Formula:C12H12N4
InChI:InChI=1/C12H12N4/c1-13-12-15-10-6-5-9-8(4-3-7-14-9)11(10)16(12)2/h3-7H,1-2H3,(H,13,15)
- Synonyms:
- 1H-Imidazo(4,5-f)quinolin-2-amine, N,1-dimethyl-
- N,1-Dimethyl-1H-imidazo(4,5-f)quinolin-2-amine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1H-Imidazo[4,5-f]quinolin-2-amine, N,1-dimethyl- REF: IN-DA0007DUCAS: 102408-28-6 | - - - | To inquire | Tue 04 Mar 25 |
![]() | 1-Methyl-2-methylaminoimidazo[4,5-F]quinoline REF: 3D-CEA40828CAS: 102408-28-6 | Min. 95% | - - - | Discontinued product |

1H-Imidazo[4,5-f]quinolin-2-amine, N,1-dimethyl-
Ref: IN-DA0007DU
Undefined size | To inquire |

1-Methyl-2-methylaminoimidazo[4,5-F]quinoline
Ref: 3D-CEA40828
1mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information |