CAS 102408-28-6
:1-Methyl-2-methylaminoimidazo[4,5-F]quinoline
Description:
1-Methyl-2-methylaminoimidazo[4,5-F]quinoline is a heterocyclic organic compound characterized by its complex structure, which includes both imidazole and quinoline moieties. This compound typically exhibits a fused ring system, contributing to its aromatic properties and potential biological activity. It is known for its role in various chemical and pharmaceutical applications, particularly in the field of medicinal chemistry, where it may serve as a scaffold for drug development. The presence of the methyl and methylamino groups can influence its solubility, reactivity, and interaction with biological targets. Additionally, compounds of this type may exhibit fluorescence properties, making them useful in analytical chemistry and imaging applications. Safety and handling considerations are essential, as with many organic compounds, due to potential toxicity or reactivity. Overall, 1-Methyl-2-methylaminoimidazo[4,5-F]quinoline represents a significant class of compounds with diverse applications in research and industry.
Formula:C12H12N4
InChI:InChI=1/C12H12N4/c1-13-12-15-10-6-5-9-8(4-3-7-14-9)11(10)16(12)2/h3-7H,1-2H3,(H,13,15)
InChI key:HKYDQRBTHFIOJG-UHFFFAOYSA-N
SMILES:CN=c1[nH]c2ccc3c(cccn3)c2n1C
Synonyms:- 1H-Imidazo(4,5-f)quinolin-2-amine, N,1-dimethyl-
- N,1-Dimethyl-1H-imidazo(4,5-f)quinolin-2-amine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1H-Imidazo[4,5-f]quinolin-2-amine, N,1-dimethyl-
CAS:Formula:C12H12N4Color and Shape:SolidMolecular weight:212.2505
