CAS 10241-97-1
:5-methylindole-2-carboxylic acid
Description:
5-Methylindole-2-carboxylic acid is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a carboxylic acid functional group (-COOH) at the 2-position and a methyl group (-CH3) at the 5-position of the indole ring contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid group. It exhibits acidic behavior, capable of donating a proton in solution. 5-Methylindole-2-carboxylic acid is of interest in various fields, including medicinal chemistry and biochemistry, as it may serve as a building block for the synthesis of more complex molecules or as a potential bioactive compound. Its reactivity can be influenced by the electron-donating and withdrawing effects of the substituents on the indole ring, making it a versatile compound for further chemical modifications.
Formula:C10H9NO2
InChI:InChI=1/C10H9NO2/c1-6-2-3-8-7(4-6)5-9(11-8)10(12)13/h2-5,11H,1H3,(H,12,13)
SMILES:Cc1ccc2c(c1)cc(C(=O)O)[nH]2
Synonyms:- 5-methyl-1H-indole-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
5-Methylindole-2-carboxylic acid, 99%
CAS:5-Methylindole-2-carboxylic acid is a compound used in the synthesis of Pin1 inhibitors as potential antitumor agents. reactant in preparation of Pin1 inhibitors as potential antitumor agents reactant in preparation of non-imidazole human histamine H4 receptor antagonists This Thermo Scientific ChemFormula:C10H9NO2Purity:99%Color and Shape:Yellow or cream to pale brown, PowderMolecular weight:175.191H-Indole-2-carboxylic acid, 5-methyl-
CAS:Formula:C10H9NO2Purity:98%Color and Shape:SolidMolecular weight:175.18405-Methylindole-2-carboxylic acid
CAS:5-Methylindole-2-carboxylic acidFormula:C10H9NO2Purity:98%Molecular weight:175.183965-Methylindole-2-carboxylic acid
CAS:5-Methylindole-2-carboxylic acid (5MICA) is a synthetic compound that has been shown to be cytotoxic in vitro. It has been shown to inhibit the growth of multiple cancer cell lines, including hepatoma cells, and is currently being studied as a potential anticancer drug. 5MICA inhibits the synthesis of protein and RNA by binding to the ribosome. This inhibition leads to cell death by apoptosis. 5MICA also exhibits an antimicrobial effect against opportunistic fungal pathogens such as Candida albicans, Aspergillus fumigatus, and Cryptococcus neoformans. The mechanism for this inhibition is unknown but may involve inhibition of protein synthesis or other cellular processes.
Formula:C10H9NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:175.18 g/mol5-Methyl-1H-indole-2-carboxylic acid
CAS:5-Methyl-1H-indole-2-carboxylic acidFormula:C10H9NO2Purity:98%Molecular weight:175.185-Methyl-1H-indole-2-carboxylic acid
CAS:Formula:C10H9NO2Purity:97%Color and Shape:SolidMolecular weight:175.1875-Methylindole-2-carboxylic acid
CAS:5-Methylindole-2-carboxylic acid is a high quality, versatile building block and research chemical that is useful in the synthesis of complex compounds, useful intermediates, and speciality chemicals. 5-Methylindole-2-carboxylic acid has been shown to be a useful scaffold for the synthesis of various 2-, 3-, and 4-substituted indoles. It has also been used as a reaction component in the synthesis of various substituted indoles. 5-Methylindole-2-carboxylic acid can be used as a reagent for the preparation of other compounds. CAS No. 10241-97-1.Formula:C10H9NO2Molecular weight:175.19 g/molRef: 3D-M-4060
-Unit-ggTo inquire25gTo inquire50gTo inquire100gTo inquire250gTo inquire500gTo inquire






