CAS 10241-97-1

5-methylindole-2-carboxylic acid

Description:

5-Methylindole-2-carboxylic acid is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a carboxylic acid functional group (-COOH) at the 2-position and a methyl group (-CH3) at the 5-position of the indole ring contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid group. It exhibits acidic behavior, capable of donating a proton in solution. 5-Methylindole-2-carboxylic acid is of interest in various fields, including medicinal chemistry and biochemistry, as it may serve as a building block for the synthesis of more complex molecules or as a potential bioactive compound. Its reactivity can be influenced by the electron-donating and withdrawing effects of the substituents on the indole ring, making it a versatile compound for further chemical modifications.

Formula: C₁₀H₉NO₂

InChI: InChI=1/C10H9NO2/c1-6-2-3-8-7(4-6)5-9(11-8)10(12)13/h2-5,11H,1H3,(H,12,13)

InChI key: DAITVOCMWPNFTL-UHFFFAOYSA-N

SMILES: Cc1ccc2c(c1)cc(C(=O)O)[nH]2

Synonyms:

• 5-methyl-1H-indole-2-carboxylic acid

5-Methylindole-2-carboxylic acid, 99%

CAS: 10241-97-1

5-Methylindole-2-carboxylic acid is a compound used in the synthesis of Pin1 inhibitors as potential antitumor agents. reactant in preparation of Pin1 inhibitors as potential antitumor agents reactant in preparation of non-imidazole human histamine H4 receptor antagonists This Thermo Scientific Chem

Formula: C₁₀H₉NO₂

Purity: 99%

Color and Shape: Yellow or cream to pale brown, Powder

Molecular weight: 175.19

Ref: 02-L17145

5-Methyl-1H-indole-2-carboxylic Acid

CAS: 10241-97-1

Formula: C₁₀H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 175.1840

Ref: IN-DA0007E4

5-Methylindole-2-carboxylic acid

CAS: 10241-97-1

Formula: C₁₀H₉NO₂

Molecular weight: 175.19

Ref: 7W-GK1292

5-Methylindole-2-carboxylic acid

CAS: 10241-97-1

5-Methylindole-2-carboxylic acid

Formula: C₁₀H₉NO₂

Purity: >98%

Molecular weight: 175.18396

Ref: 54-OR903329

5-Methyl-1H-indole-2-carboxylic acid

CAS: 10241-97-1

5-Methyl-1H-indole-2-carboxylic acid

Formula: C₁₀H₉NO₂

Purity: 98%

Molecular weight: 175.18

Ref: IN-DG104872

5-Methylindole-2-carboxylic acid

CAS: 10241-97-1

5-Methylindole-2-carboxylic acid (5MICA) is a synthetic compound that has been shown to be cytotoxic in vitro. It has been shown to inhibit the growth of multiple cancer cell lines, including hepatoma cells, and is currently being studied as a potential anticancer drug. 5MICA inhibits the synthesis of protein and RNA by binding to the ribosome. This inhibition leads to cell death by apoptosis. 5MICA also exhibits an antimicrobial effect against opportunistic fungal pathogens such as Candida albicans, Aspergillus fumigatus, and Cryptococcus neoformans. The mechanism for this inhibition is unknown but may involve inhibition of protein synthesis or other cellular processes.

Formula: C₁₀H₉NO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 175.18 g/mol

Ref: 3D-FM30495

5-Methyl-1H-indole-2-carboxylic acid

CAS: 10241-97-1

Formula: C₁₀H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 175.187

Ref: 10-F092830