CymitQuimica logo

CAS 102410-25-3

:

2,6-DIMETHYLIMIDAZO[2,1-B][1,3]THIAZOLE-5-CARBALDEHYDE

Description:
2,6-Dimethylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde is a heterocyclic organic compound characterized by its complex structure, which includes both imidazole and thiazole rings. This compound features two methyl groups at the 2 and 6 positions of the imidazole ring, contributing to its unique chemical properties. The presence of a formyl group (-CHO) at the 5-position of the thiazole ring indicates its potential reactivity, particularly in condensation reactions and as an electrophile in various organic syntheses. The compound is likely to exhibit moderate solubility in polar organic solvents due to its functional groups. Its structure suggests potential applications in medicinal chemistry, particularly in the development of bioactive compounds, as similar derivatives have been studied for their pharmacological properties. Additionally, the presence of both nitrogen and sulfur in the ring system may impart interesting electronic characteristics, influencing its reactivity and interactions with biological targets. Overall, 2,6-dimethylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C8H8N2OS
InChI:InChI=1/C8H8N2OS/c1-5-3-10-7(4-11)6(2)9-8(10)12-5/h3-4H,1-2H3
InChI key:QYPQGPDZMPQWMT-UHFFFAOYSA-N
SMILES:Cc1cn2c(C=O)c(C)nc2s1
Found 2 products.