CymitQuimica logo

CAS 1024120-52-2

:

1-(1-ETHOXYETHYL)-4-BROMO PYRAZOLE

Description:
1-(1-Ethoxyethyl)-4-bromo pyrazole is a chemical compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of the ethoxyethyl group contributes to its solubility and reactivity, while the bromine atom at the 4-position of the pyrazole ring introduces a halogen that can participate in various chemical reactions, such as nucleophilic substitutions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in agrochemicals or as a building block in organic synthesis. The compound's properties, such as melting point, boiling point, and reactivity, would depend on its specific molecular interactions and the environment in which it is used. Safety data sheets should be consulted for handling and storage guidelines, as the presence of bromine may pose certain hazards. Overall, 1-(1-ethoxyethyl)-4-bromo pyrazole represents a versatile compound with potential utility in various chemical applications.
Formula:C7H11BrN2O
InChI:InChI=1S/C7H11BrN2O/c1-3-11-6(2)10-5-7(8)4-9-10/h4-6H,3H2,1-2H3
InChI key:DZXRSNUJYPTUFF-UHFFFAOYSA-N
SMILES:CCOC(C)N1C=C(C=N1)Br
Found 5 products.