CymitQuimica logo

CAS 10242-13-4

:

3-Carboxy-6-methylcoumarin

Description:
3-Carboxy-6-methylcoumarin is a chemical compound belonging to the coumarin family, characterized by its fused benzene and α-pyrone rings. This compound features a carboxylic acid group at the 3-position and a methyl group at the 6-position of the coumarin structure, which contributes to its unique properties. It is typically a yellow to orange crystalline solid, exhibiting fluorescence, which makes it useful in various applications, including as a fluorescent probe in biochemical assays. The presence of the carboxylic acid group enhances its solubility in polar solvents, while the methyl group can influence its reactivity and stability. 3-Carboxy-6-methylcoumarin can undergo various chemical reactions, such as esterification and amidation, allowing for the synthesis of derivatives with tailored properties. Additionally, it has been studied for its potential biological activities, including antimicrobial and anticancer properties. Overall, this compound is of interest in both synthetic organic chemistry and medicinal chemistry due to its versatile reactivity and biological significance.
Formula:C11H8O4
InChI:InChI=1S/C11H8O4/c1-6-2-3-9-7(4-6)5-8(10(12)13)11(14)15-9/h2-5H,1H3,(H,12,13)
InChI key:InChIKey=FJICLQQBBFWGMZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=2C(OC1=O)=CC=C(C)C2
Synonyms:
  • 6-Methyl-2-oxo-2H-1-benzopyran-3-carboxylic acid
  • 6-Methylcoumarin-3-carboxylic acid
  • 2H-1-Benzopyran-3-carboxylic acid, 6-methyl-2-oxo-
  • 6-Methyl-2-oxo-2H-chromene-3-carboxylic acid
  • 3-Carboxy-6-methylcoumarin
Found 2 products.