CymitQuimica logo

CAS 102423-74-5

:

4H-Thiopyran-3,5-dicarbonitrile, 2,6-diamino-4-(4-methoxyphenyl)-

Description:
4H-Thiopyran-3,5-dicarbonitrile, 2,6-diamino-4-(4-methoxyphenyl)-, identified by its CAS number 102423-74-5, is a heterocyclic organic compound featuring a thiopyran ring structure. This compound is characterized by the presence of two cyano groups (-C≡N) at the 3 and 5 positions of the thiopyran ring, which contribute to its reactivity and potential applications in organic synthesis. The presence of a 4-(4-methoxyphenyl) substituent indicates that it has an aromatic component, which can influence its electronic properties and solubility. Additionally, the 2,6-diamino substituents suggest that the compound may exhibit basic properties and could participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Overall, this compound's unique structure and functional groups make it of interest in fields such as medicinal chemistry and materials science, where it may serve as a precursor for more complex molecules or as a potential pharmacophore.
Formula:C14H12N4OS
InChI:InChI=1S/C14H12N4OS/c1-19-9-4-2-8(3-5-9)12-10(6-15)13(17)20-14(18)11(12)7-16/h2-5,12H,17-18H2,1H3
InChI key:QJOUOBNQMLXGNN-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)C2C(=C(SC(=C2C#N)N)N)C#N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.