CymitQuimica logo

CAS 102432-05-3

:

3-(1H-IMIDAZOL-1-YLMETHYL)BENZALDEHYDE

Description:
3-(1H-Imidazol-1-ylmethyl)benzaldehyde is an organic compound characterized by its imidazole and benzaldehyde functional groups. It features a benzaldehyde moiety, which is a derivative of benzene with a formyl group (-CHO) attached, and an imidazole ring, a five-membered heterocyclic structure containing two nitrogen atoms. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in pharmaceuticals and organic synthesis due to the reactivity of both the aldehyde and imidazole functionalities. The presence of the imidazole group may impart biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit properties such as solubility in organic solvents and varying stability under different pH conditions. Its synthesis often involves the reaction of appropriate precursors, and it can be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity.
Formula:C11H10N2O
InChI:InChI=1/C11H10N2O/c14-8-11-3-1-2-10(6-11)7-13-5-4-12-9-13/h1-6,8-9H,7H2
InChI key:JMKQKKQFLYPQDD-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)C=O)Cn1ccnc1
Synonyms:
  • 3-(1H-Imidazol-1-ylmethyl)benzaldehyde 97%
Found 2 products.