CymitQuimica logo

CAS 102450-20-4

:

3-Piperidinemethanol, 1-propyl-

Description:
3-Piperidinemethanol, 1-propyl- is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a propyl group attached to the nitrogen of the piperidine and a hydroxymethyl group (-CH2OH) at the 3-position of the ring. It is typically a colorless to pale yellow liquid with a moderate boiling point and is soluble in water and various organic solvents, reflecting its polar nature due to the hydroxyl group. The presence of the piperidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are known for their biological activity. Additionally, the compound may exhibit properties such as basicity due to the nitrogen atom, which can participate in hydrogen bonding. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H19NO
InChI:InChI=1S/C9H19NO/c1-2-5-10-6-3-4-9(7-10)8-11/h9,11H,2-8H2,1H3
InChI key:BJTTYMDZZCMDST-UHFFFAOYSA-N
SMILES:CCCN1CCCC(C1)CO
Found 1 products.