CymitQuimica logo

CAS 1024580-16-2

:

[3-(2-Chloro-6-fluorophenyl)-5-methyl-4-isoxazolyl](3,4-dihydro-6-methyl-1(2H)-quinolinyl)methanone

Description:
The chemical substance known as [3-(2-Chloro-6-fluorophenyl)-5-methyl-4-isoxazolyl](3,4-dihydro-6-methyl-1(2H)-quinolinyl)methanone, with the CAS number 1024580-16-2, is a complex organic compound characterized by its unique structural features. It contains an isoxazole ring, which is a five-membered heterocyclic compound with nitrogen and oxygen, contributing to its potential biological activity. The presence of a chloro and a fluoro substituent on the phenyl group enhances its lipophilicity and may influence its interaction with biological targets. Additionally, the quinoline moiety, known for its pharmacological properties, suggests potential applications in medicinal chemistry. The compound's molecular structure indicates it may exhibit specific reactivity patterns, making it of interest in drug development and research. Its synthesis and characterization would typically involve advanced organic chemistry techniques, and its properties, such as solubility, stability, and biological activity, would be critical for evaluating its potential applications in pharmaceuticals or agrochemicals.
Formula:C21H18ClFN2O2
InChI:InChI=1S/C21H18ClFN2O2/c1-12-8-9-17-14(11-12)5-4-10-25(17)21(26)18-13(2)27-24-20(18)19-15(22)6-3-7-16(19)23/h3,6-9,11H,4-5,10H2,1-2H3
InChI key:InChIKey=NGOAMQXGEDQHGZ-UHFFFAOYSA-N
SMILES:C(=O)(C=1C(=NOC1C)C2=C(Cl)C=CC=C2F)N3C=4C(CCC3)=CC(C)=CC4
Synonyms:
  • Methanone, [3-(2-chloro-6-fluorophenyl)-5-methyl-4-isoxazolyl](3,4-dihydro-6-methyl-1(2H)-quinolinyl)-
  • [3-(2-Chloro-6-fluorophenyl)-5-methyl-4-isoxazolyl](3,4-dihydro-6-methyl-1(2H)-quinolinyl)methanone
Found 1 products.