CymitQuimica logo

CAS 102488-47-1

:

1H,1H,2H,2H-perfluorooctyldimethylchlorosilane

Description:
1H,1H,2H,2H-Perfluorooctyldimethylchlorosilane, with CAS number 102488-47-1, is a silane compound characterized by its unique structure that includes a perfluorinated octyl group and dimethyl groups attached to a silicon atom. This compound is notable for its hydrophobic and oleophobic properties, making it useful in various applications, including surface modification and as a coating agent. The presence of fluorine atoms contributes to its low surface energy, enhancing its resistance to water and oils. Additionally, the chlorosilane functional group allows for reactivity with surfaces, facilitating the formation of stable siloxane bonds upon hydrolysis. This compound is typically used in the production of fluorinated coatings, adhesives, and sealants, as well as in the semiconductor industry for surface treatment. Safety considerations include handling precautions due to its potential reactivity and toxicity, particularly in its unreacted form. Overall, 1H,1H,2H,2H-perfluorooctyldimethylchlorosilane is valued for its unique chemical properties that enhance material performance in various industrial applications.
Formula:C10H10ClF13Si
InChI:InChI=1/C10H10ClF13Si/c1-25(2,11)4-3-5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)24/h3-4H2,1-2H3
InChI key:AKYGPHVLITVSJE-UHFFFAOYSA-N
SMILES:C[Si](C)(CCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)Cl
Synonyms:
  • (Tridecafluoro-1,1,2,2-tetrahydrooctyl)dimethylchlorosilane
  • Perfluorooctyldimethylchlorosilane
  • Chlorodimethyl-1H,1H,2H,2H-perfluorooctylsilane
  • Chloro(Dimethyl)(3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl)Silane
Found 7 products.