CymitQuimica logo

CAS 102488-50-6

:

1H,1H,2H,2H-PERFLUOROTETRADECYLTRICHLOROSILANE

Description:
1H,1H,2H,2H-Perfluorotetradecyltrichlorosilane is a fluorinated silane compound characterized by its long perfluorinated alkyl chain, which imparts unique properties such as hydrophobicity and oleophobicity. This compound features a silane group that can react with various substrates, making it useful for surface modification applications. The presence of three chlorine atoms enhances its reactivity, allowing it to form covalent bonds with surfaces, thereby improving resistance to moisture and chemical attack. Its perfluorinated structure contributes to low surface energy, making it effective in reducing friction and adhesion. This compound is typically used in the production of coatings, sealants, and in the treatment of materials to impart water and oil repellency. Additionally, due to its fluorinated nature, it may exhibit stability under a range of environmental conditions, although handling precautions are necessary due to potential toxicity and environmental concerns associated with fluorinated compounds. Overall, 1H,1H,2H,2H-Perfluorotetradecyltrichlorosilane is valued in various industrial applications for its unique surface properties.
Formula:C14H4Cl3F25Si
InChI:InChI=1/C14H4Cl3F25Si/c15-43(16,17)2-1-3(18,19)4(20,21)5(22,23)6(24,25)7(26,27)8(28,29)9(30,31)10(32,33)11(34,35)12(36,37)13(38,39)14(40,41)42/h1-2H2
InChI key:XHHTUOVNMZYWFH-UHFFFAOYSA-N
SMILES:C(C[Si](Cl)(Cl)Cl)C(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:
  • 1H,1H,2H,2H-Perfluorotetradecyltrichlorosilane 97%
  • 1H,1H,2H,2H-Perfluorotetradecyltrichlorosilane97%
  • Trichloro(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-Pentacosafluorotetradecyl)Silane
Found 2 products.