CymitQuimica logo

CAS 102490-05-1

:

[1,1'-Binaphthalene]-2,2'-diol, 3,3'-diphenyl-, (1S)-

Description:
[1,1'-Binaphthalene]-2,2'-diol, 3,3'-diphenyl-, (1S)-, with CAS number 102490-05-1, is a chiral organic compound characterized by its binaphthalene structure, which consists of two naphthalene units connected by a central carbon atom bearing hydroxyl groups. This compound exhibits significant optical activity due to its stereogenic centers, making it useful in asymmetric synthesis and as a chiral auxiliary in various chemical reactions. The presence of hydroxyl groups contributes to its solubility in polar solvents and can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the diphenyl substituents enhance its stability and may affect its electronic properties, making it a candidate for applications in materials science and organic electronics. Its unique structural features and chirality make it a valuable compound in the field of organic chemistry, particularly in the development of new synthetic methodologies and in the study of stereochemistry.
Formula:C32H22O2
InChI:InChI=1S/C32H22O2/c33-31-27(21-11-3-1-4-12-21)19-23-15-7-9-17-25(23)29(31)30-26-18-10-8-16-24(26)20-28(32(30)34)22-13-5-2-6-14-22/h1-20,33-34H
InChI key:UXSXQZYUHXUTTI-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=CC3=CC=CC=C3C(=C2O)C4=C(C(=CC5=CC=CC=C54)C6=CC=CC=C6)O
Found 5 products.