CAS 102491-80-5
:2-Demethyl Colchicine
Description:
2-Demethyl Colchicine is a chemical compound derived from colchicine, a natural alkaloid primarily obtained from the plant Colchicum autumnale. This compound is characterized by its structural modifications that influence its biological activity. It typically exhibits a complex molecular structure featuring a phenanthrene core, which is essential for its interaction with cellular components. 2-Demethyl Colchicine is known for its role in inhibiting microtubule polymerization, making it significant in research related to cancer treatment and cellular processes. The compound is often studied for its potential therapeutic applications, particularly in the context of anti-inflammatory and anticancer properties. Additionally, it may exhibit varying solubility in organic solvents and has specific stability conditions that are crucial for its handling and storage. As with many alkaloids, safety precautions are necessary due to its potential toxicity and side effects. Overall, 2-Demethyl Colchicine serves as an important compound in medicinal chemistry and pharmacology, contributing to the understanding of microtubule dynamics and their implications in disease.
Formula:C21H23NO6
InChI:InChI=1/C21H23NO6/c1-11(23)22-15-7-5-12-9-18(27-3)20(25)21(28-4)19(12)13-6-8-17(26-2)16(24)10-14(13)15/h6,8-10,15,25H,5,7H2,1-4H3,(H,22,23)/t15-/m0/s1
SMILES:CC(=N[C@H]1CCc2cc(c(c(c2c2ccc(c(=O)cc12)OC)OC)O)OC)O
Synonyms:- N-[(7S)-5,6,7,9-Tetrahydro-2-hydroxy-1,3,10-trimethoxy-9-oxobenzo[a]heptalen-7-yl]acetamide
- Nsc 18053
- O2-Demethylcolchicine
- Nsc 180533
- N-[(7S)-2-hydroxy-1,3,10-trimethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl]acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Acetamide, N-(5,6,7,9-tetrahydro-2-hydroxy-1,3,10-trimethoxy-9-oxobenzo[a]heptalen-7-yl)-
CAS:Formula:C21H23NO6Purity:95%Color and Shape:SolidMolecular weight:385.41042-Demethyl Colchicine
CAS:Applications A metabolite of Colchicine (C640000). Has shown anti-tumor activity.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Martinez, M., et al.: J. Appl. Toxicol., 15, 49 (1995), De Vincenzo, R., et al.: Oncol. Res., 11, 145(1999), Das, D., et al.: Biochim. Biophys. Acta., 1502, 351 (2000), Wagner, B., et al.: J. Biol. Chem., 275, 22461(2000),Formula:C21H23NO6Color and Shape:NeatMolecular weight:385.412-Demethyl colchicine
CAS:2-Demethyl colchicine is a natural compound that belongs to the group of flavonoids. It has been shown to have anti-inflammatory properties and has been studied for its ability to inhibit the formation of leukotrienes, which are important mediators in allergic reactions. 2-Demethyl colchicine also reduces inflammation caused by excessive production of nitric oxide, which can lead to inflammatory diseases such as atherosclerosis. 2-Demethyl colchicine has a high affinity for potassium dichromate, with a formation rate of 1:1.Formula:C21H23NO6Purity:Min. 94 Area-%Color and Shape:PowderMolecular weight:385.41 g/mol




