
CAS 1025064-33-8
:N-(1-(naphthalen-2-yl)ethyl)-3-(3-(trifluoromethyl)phenyl)propan-1-amine hydrochloride
Description:
N-(1-(naphthalen-2-yl)ethyl)-3-(3-(trifluoromethyl)phenyl)propan-1-amine hydrochloride is a synthetic organic compound characterized by its complex structure, which includes a naphthalene moiety and a trifluoromethyl-substituted phenyl group. This compound is typically classified as a substituted amine, featuring a propan-1-amine backbone. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, potentially making it a candidate for pharmaceutical applications. The hydrochloride salt form indicates that it is often used in a stable, soluble form suitable for various chemical and biological assays. Its molecular structure suggests potential interactions with biological targets, which may be of interest in medicinal chemistry. As with many synthetic compounds, safety and handling precautions are essential, particularly due to the presence of fluorinated groups, which can exhibit unique reactivity and toxicity profiles. Overall, this compound's unique structural features may contribute to its potential utility in research and development within the fields of medicinal chemistry and pharmacology.
Formula:C22H23ClF3N
InChI:InChI=1S/C22H22F3N.ClH/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26-14-6-8-17-7-4-11-19(15-17)22(23,24)25;/h2-5,7,9-13,15-16,26H,6,8,14H2,1H3;1H
InChI key:QANQWUQOEJZMLL-UHFFFAOYSA-N
SMILES:CC(C1=CC=CC2=CC=CC=C21)NCCCC3=CC(=CC=C3)C(F)(F)F.Cl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
rac-Cinacalcet HCl
CAS:Formula:C22H22F3N·HClColor and Shape:White To Off-White SolidMolecular weight:357.42 36.46Cinacalcet Impurity 36
CAS:Formula:C22H22F3NOColor and Shape:White To Off-White SolidMolecular weight:373.42

