CymitQuimica logo

CAS 1025127-32-5

:

5-amino-2-fluoro-3-hydroxybenzoic acid

Description:
5-Amino-2-fluoro-3-hydroxybenzoic acid is an aromatic compound characterized by the presence of an amino group (-NH2), a hydroxy group (-OH), and a fluoro group (-F) attached to a benzoic acid framework. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The amino group can participate in hydrogen bonding, enhancing its solubility in polar solvents, while the hydroxy group also contributes to its potential reactivity and solubility. The presence of the fluorine atom can influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological systems. This compound may be of interest in pharmaceutical research due to its structural features, which could be relevant for drug design or as a biochemical probe. Additionally, its unique combination of functional groups may impart specific biological activities, making it a candidate for further investigation in medicinal chemistry. Overall, 5-amino-2-fluoro-3-hydroxybenzoic acid exhibits a blend of properties that could be valuable in various chemical and biological applications.
Formula:C7H6FNO3
InChI:InChI=1S/C7H6FNO3/c8-6-4(7(11)12)1-3(9)2-5(6)10/h1-2,10H,9H2,(H,11,12)
InChI key:MTWVJKPFMPPDPV-UHFFFAOYSA-N
SMILES:C1=C(C=C(C(=C1C(=O)O)F)O)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.