CymitQuimica logo

CAS 1025127-35-8

:

5-Amino-2,4-difluoro-3-hydroxybenzoic acid

Description:
5-Amino-2,4-difluoro-3-hydroxybenzoic acid is an aromatic compound characterized by the presence of an amino group, two fluorine atoms, and a hydroxyl group attached to a benzoic acid framework. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The amino group (-NH2) enhances its potential for hydrogen bonding, influencing its solubility in polar solvents. The difluorination at the 2 and 4 positions introduces significant electronegativity, which can affect the compound's reactivity and stability. The hydroxyl group (-OH) also plays a crucial role in solubility and can participate in hydrogen bonding. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its unique combination of functional groups suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Overall, 5-Amino-2,4-difluoro-3-hydroxybenzoic acid is a versatile compound with properties that warrant further investigation in various chemical and biological contexts.
Formula:C7H5F2NO3
InChI:InChI=1S/C7H5F2NO3/c8-4-2(7(12)13)1-3(10)5(9)6(4)11/h1,11H,10H2,(H,12,13)
InChI key:InChIKey=RQIRQOCTOBXYQC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)C(O)=C(F)C(N)=C1
Synonyms:
  • Benzoic acid, 5-amino-2,4-difluoro-3-hydroxy-
  • 5-Amino-2,4-difluoro-3-hydroxybenzoic acid
Found 1 products.