CAS 10252-68-3
:4-[(isobutylamino)sulfonyl]benzoic acid
Description:
4-[(Isobutylamino)sulfonyl]benzoic acid, with the CAS number 10252-68-3, is a chemical compound characterized by its sulfonamide functional group attached to a benzoic acid structure. This compound typically exhibits properties associated with both acidic and basic functionalities due to the carboxylic acid group and the amine group, respectively. It is often used in pharmaceutical applications, particularly as a potential intermediate in the synthesis of various biologically active molecules. The presence of the isobutylamino group contributes to its lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the sulfonyl group enhances the compound's stability and can affect its reactivity. The compound may also exhibit specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H15NO4S
InChI:InChI=1S/C11H15NO4S/c1-8(2)7-12-17(15,16)10-5-3-9(4-6-10)11(13)14/h3-6,8,12H,7H2,1-2H3,(H,13,14)
InChI key:VKGRSBHIZXZUIB-UHFFFAOYSA-N
SMILES:CC(C)CNS(=O)(=O)C1=CC=C(C=C1)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
