CymitQuimica logo

CAS 102539-53-7

:

1H-Inden-1-one, 4-bromo-2,3-dihydro-3-methyl-

Description:
1H-Inden-1-one, 4-bromo-2,3-dihydro-3-methyl- is an organic compound characterized by its bicyclic structure, which includes an indene framework with a ketone functional group. The presence of a bromine atom at the 4-position and a methyl group at the 3-position of the indene ring contributes to its unique reactivity and physical properties. This compound typically exhibits a pale yellow to brown appearance and is soluble in organic solvents. Its molecular structure suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. The bromine substituent can facilitate further chemical modifications, making it a versatile intermediate in synthetic pathways. Additionally, the compound may exhibit interesting biological activities, although specific studies would be required to elucidate its pharmacological properties. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with brominated compounds.
Formula:C10H9BrO
InChI:InChI=1S/C10H9BrO/c1-6-5-9(12)7-3-2-4-8(11)10(6)7/h2-4,6H,5H2,1H3
InChI key:KRXGZWSZRJEHMX-UHFFFAOYSA-N
SMILES:CC1CC(=O)C2=C1C(=CC=C2)Br
Synonyms:
  • 1H-Inden-1-one, 4-bromo-2,3-dihydro-3-methyl-
  • 4-bromo-3-methyl-2,3-dihydro-1H-inden-1-one
Found 5 products.