CymitQuimica logo

CAS 10254-07-6

:

N-Benzhydryl-2-chloro-acetamide

Description:
N-Benzhydryl-2-chloro-acetamide is an organic compound characterized by its amide functional group, which is derived from benzhydryl and 2-chloroacetic acid. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents. Its structure features a benzhydryl group, which contributes to its hydrophobic characteristics, and a chloro substituent that can influence its reactivity and biological activity. N-Benzhydryl-2-chloro-acetamide may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for pharmaceutical applications, particularly in the development of drugs targeting specific biological pathways. The presence of the chloro group can enhance its electrophilic nature, making it useful in various chemical reactions. Safety data sheets should be consulted for handling and storage guidelines, as the compound may pose health risks if not managed properly. Overall, N-Benzhydryl-2-chloro-acetamide is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C15H14ClNO
InChI:InChI=1S/C15H14ClNO/c16-11-14(18)17-15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,15H,11H2,(H,17,18)
InChI key:YNIDNLNUYCFFTA-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C(C2=CC=CC=C2)NC(=O)CCl
Found 3 products.