CAS 102541-24-2
:4H-1-Benzopyran-4-one, 6-chloro-2,3-dihydro-7-methyl-
Description:
4H-1-Benzopyran-4-one, 6-chloro-2,3-dihydro-7-methyl- is a chemical compound that belongs to the class of flavonoids, which are known for their diverse biological activities. This compound features a benzopyran core structure, characterized by a fused benzene and pyran ring, with specific substitutions that influence its chemical properties and reactivity. The presence of a chlorine atom at the 6-position and a methyl group at the 7-position contributes to its unique characteristics, potentially affecting its solubility, stability, and interaction with biological targets. Compounds of this nature often exhibit antioxidant, anti-inflammatory, and antimicrobial properties, making them of interest in pharmaceutical and nutraceutical research. The molecular structure can also suggest potential applications in the development of dyes or pigments due to the conjugated system present in the benzopyran framework. Overall, the specific characteristics of this compound can be further explored through experimental studies to elucidate its full range of biological and chemical behaviors.
Formula:C10H9ClO2
InChI:InChI=1S/C10H9ClO2/c1-6-4-10-7(5-8(6)11)9(12)2-3-13-10/h4-5H,2-3H2,1H3
InChI key:ABNQLTZOCRGBPC-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C1Cl)C(=O)CCO2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4H-1-Benzopyran-4-one, 6-chloro-2,3-dihydro-7-methyl-
CAS:Formula:C10H9ClO2Molecular weight:196.63026000000002
