CymitQuimica logo

CAS 102547-84-2

:

9-METHYL-3,9-DIAZABICYCLO[4.2.1]NONANE

Description:
9-Methyl-3,9-diazabicyclo[4.2.1]nonane, with the CAS number 102547-84-2, is a bicyclic organic compound characterized by its unique structure, which includes a bicyclic framework and two nitrogen atoms incorporated into the ring system. This compound features a methyl group at the 9-position, contributing to its overall stability and reactivity. The presence of nitrogen atoms in the bicyclic structure imparts basic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its bicyclic nature may also influence its conformational flexibility and steric interactions, which are important in determining its reactivity and potential applications in organic synthesis or medicinal chemistry. Additionally, the compound's solubility and stability in different solvents can vary, affecting its practical use in laboratory settings. Overall, 9-methyl-3,9-diazabicyclo[4.2.1]nonane is of interest for its structural features and potential applications in various chemical fields.
Formula:C8H16N2
InChI:InChI=1S/C8H16N2/c1-10-7-2-3-8(10)6-9-5-4-7/h7-9H,2-6H2,1H3
InChI key:NRCDIJJTFDJACX-UHFFFAOYSA-N
SMILES:CN1C2CCC1CNCC2
Found 5 products.