CAS 10255-95-5: 2-Phenylmalonamide

Description:2-Phenylmalonamide is an organic compound characterized by its structure, which features a malonamide backbone substituted with a phenyl group. This compound typically appears as a white to off-white solid and is known for its potential applications in organic synthesis and medicinal chemistry. It possesses functional groups that can participate in various chemical reactions, making it a versatile intermediate in the synthesis of more complex molecules. The presence of the amide functional groups contributes to its ability to form hydrogen bonds, influencing its solubility and reactivity. Additionally, 2-Phenylmalonamide may exhibit biological activity, which can be explored for pharmaceutical applications. Its melting point, boiling point, and solubility characteristics can vary based on purity and environmental conditions. Safety data should be consulted to handle the compound appropriately, as it may pose health risks if ingested or inhaled. Overall, 2-Phenylmalonamide is a noteworthy compound in the field of organic chemistry, with potential implications in various research and industrial applications.

Formula:C₉H₁₀N₂O₂

InChI:InChI=1/C9H10N2O2/c10-8(12)7(9(11)13)6-4-2-1-3-5-6/h1-5,7H,(H2,10,12)(H2,11,13)

Synonyms:
2-Phenylmalondiamide
2-Phenylpropanediamide

Found 5 products.

Product data	Purity	Price range	Estimated delivery
2-Phenylmalonamide, 97% REF: 02-B24972CAS: 10255-95-5	97%	To inquire	Fri 18 Jul 25
Propanediamide, 2-phenyl- REF: IN-DA0007PWCAS: 10255-95-5	97%	To inquire	Thu 24 Jul 25
2-Phenylmalonamide REF: 54-OR1010595CAS: 10255-95-5	97%	32.00 €~2,496.00 €	Fri 25 Jul 25
2-Phenylmalonamide REF: 10-F790492CAS: 10255-95-5	98%	To inquire	Tue 05 Aug 25
2-Phenylmalonamide REF: 3D-KAA25595CAS: 10255-95-5	Min. 95%	- - -	Discontinued product