CAS 10255-95-5
:2-Phenylmalonamide
Description:
2-Phenylmalonamide is an organic compound characterized by its structure, which features a malonamide backbone substituted with a phenyl group. This compound typically appears as a white to off-white solid and is known for its potential applications in organic synthesis and medicinal chemistry. It possesses functional groups that can participate in various chemical reactions, making it a versatile intermediate in the synthesis of more complex molecules. The presence of the amide functional groups contributes to its ability to form hydrogen bonds, influencing its solubility and reactivity. Additionally, 2-Phenylmalonamide may exhibit biological activity, which can be explored for pharmaceutical applications. Its melting point, boiling point, and solubility characteristics can vary based on purity and environmental conditions. Safety data should be consulted to handle the compound appropriately, as it may pose health risks if ingested or inhaled. Overall, 2-Phenylmalonamide is a noteworthy compound in the field of organic chemistry, with potential implications in various research and industrial applications.
Formula:C9H10N2O2
InChI:InChI=1/C9H10N2O2/c10-8(12)7(9(11)13)6-4-2-1-3-5-6/h1-5,7H,(H2,10,12)(H2,11,13)
SMILES:c1ccc(cc1)C(C(=N)O)C(=N)O
Synonyms:- 2-Phenylmalondiamide
- 2-Phenylpropanediamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Phenylmalonamide, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H10N2O2Purity:97%Color and Shape:Crystals or powder or crystalline powder, WhiteMolecular weight:178.19




