CymitQuimica logo

CAS 1025504-45-3

:

L-Valine (2R,3R,11bR)-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-3-(2-methylpropyl)-2H-benzo[a]quinolizin-2-yl ester

Description:
L-Valine, specifically the compound with the name "(2R,3R,11bR)-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-3-(2-methylpropyl)-2H-benzo[a]quinolizin-2-yl ester" and CAS number 1025504-45-3, is a complex organic molecule that features a unique bicyclic structure. This compound is characterized by its multiple chiral centers, which contribute to its stereochemistry and potential biological activity. The presence of methoxy groups indicates that it may exhibit specific interactions with biological targets, potentially influencing its solubility and reactivity. As an ester, it may also be involved in hydrolysis reactions, which could affect its stability and bioavailability. The branched alkyl group (2-methylpropyl) suggests that it may have lipophilic properties, potentially enhancing its membrane permeability. Overall, this compound's structural features suggest it could have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C24H38N2O4
InChI:InChI=1S/C24H38N2O4/c1-14(2)9-17-13-26-8-7-16-10-21(28-5)22(29-6)11-18(16)19(26)12-20(17)30-24(27)23(25)15(3)4/h10-11,14-15,17,19-20,23H,7-9,12-13,25H2,1-6H3/t17-,19-,20-,23+/m1/s1
InChI key:InChIKey=GEJDGVNQKABXKG-CFKGEZKQSA-N
SMILES:O(C([C@H](C(C)C)N)=O)[C@@H]1C[C@@]2(C=3C(=CC(OC)=C(OC)C3)CCN2C[C@H]1CC(C)C)[H]
Synonyms:
  • NBI 98854
  • L-Valine, (2R,3R,11bR)-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-3-(2-methylpropyl)-2H-benzo[a]quinolizin-2-yl ester
  • L-Valine (2R,3R,11bR)-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-3-(2-methylpropyl)-2H-benzo[a]quinolizin-2-yl ester
  • Ingrezza
  • Valbenazine
Found 11 products.