CymitQuimica logo

CAS 10256-01-6

:

1,3-DI-MORPHOLIN-4-YL-PROPANE-1,3-DIONE

Description:
1,3-Di-morpholin-4-yl-propane-1,3-dione, with the CAS number 10256-01-6, is an organic compound characterized by its unique structure that includes two morpholine rings and a dione functional group. This compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of the morpholine moieties, which enhance its solubility profile. The morpholine rings contribute to its potential as a chelating agent, making it useful in various chemical applications, including coordination chemistry and as a building block in organic synthesis. The presence of the dione functional groups suggests that it may exhibit reactivity typical of diketones, such as undergoing condensation reactions or acting as a nucleophile. Additionally, the compound may possess biological activity, which could be explored for pharmaceutical applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H18N2O4
InChI:InChI=1/C11H18N2O4/c14-10(12-1-5-16-6-2-12)9-11(15)13-3-7-17-8-4-13/h1-9H2
InChI key:DPNZFWSVHKTMAF-UHFFFAOYSA-N
SMILES:C1COCCN1C(=O)CC(=O)N1CCOCC1
Synonyms:
  • 1,3-Propanedione, 1,3-Di-4-Morpholinyl-
Found 3 products.