CAS 102577-03-7
:Fengycin
Description:
Fengycin is a lipopeptide antibiotic produced by certain strains of the bacterium Bacillus subtilis. It is primarily known for its antimicrobial properties, particularly against Gram-positive bacteria and some fungi. The structure of Fengycin consists of a cyclic peptide linked to a fatty acid tail, which contributes to its membrane-disrupting activity. This amphiphilic nature allows Fengycin to interact with lipid membranes, leading to cell lysis in susceptible organisms. Fengycin is also noted for its potential applications in agriculture as a biopesticide, as it can inhibit plant pathogens. Additionally, research has indicated that Fengycin may possess anti-biofilm properties, making it a candidate for combating biofilm-associated infections. Its biosynthesis is regulated by environmental factors, and it is produced in varying amounts depending on the growth conditions of the producing strain. Overall, Fengycin represents a significant area of interest in both microbiology and biotechnology due to its unique properties and potential applications.
Formula:Unspecified
InChI:InChI=1/C72H110N12O20/c1-6-8-9-10-11-12-13-14-15-16-17-20-48(87)41-58(89)76-51(32-35-59(90)91)65(96)77-50(21-18-37-73)64(95)80-55-40-46-25-29-49(30-26-46)104-72(103)61(42(3)7-2)82-67(98)54(39-45-23-27-47(86)28-24-45)81-66(97)52(31-34-57(74)88)78-69(100)56-22-19-38-84(56)71(102)43(4)75-63(94)53(33-36-60(92)93)79-70(101)62(44(5)85)83-68(55)99/h23-30,42-44,48,50-56,61-62,85-87H,6-22,31-41,73H2,1-5H3,(H2,74,88)(H,75,94)(H,76,89)(H,77,96)(H,78,100)(H,79,101)(H,80,95)(H,81,97)(H,82,98)(H,83,99)(H,90,91)(H,92,93)/t42-,43-,44+,48?,50-,51+,52+,53+,54+,55+,56+,61+,62+/m1/s1
Synonyms:- Fengymycin
- N-(3-hydroxyhexadecanoyl)-L-alpha-glutamyl-N-{(3S,6S,9S,17R,20S,23S,26R,31aS)-3-(3-amino-3-oxopropyl)-9-[(2R)-butan-2-yl]-23-(2-carboxyethyl)-6-(4-hydroxybenzyl)-20-[(1S)-1-hydroxyethyl]-26-methyl-1,4,7,10,18,21,24,27-octaoxo-1,2,3,4,5,6,7,8,9,10,16,17,18,19,20,21,22,23,24,25,26,27,29,30,31,31a-hexacosahydro-12,15-ethenopyrrolo[2,1-l][1,4,7,10,13,16,19,22]oxaheptaazacyclononacosin-17-yl}-D-ornithinamide
- Fengycin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Fengycin
CAS:<p>Fengycin (fengmycin), a cyclic lipopeptide produced by Bacillus subtilis, is a biosurfactant with antifungal and biodegradable properties.</p>Formula:C72H110N12O20Color and Shape:SolidMolecular weight:1463.71Fengycin A analogue
CAS:<p>Fengycin A analogue is an antifungal lipopeptide, which is a cyclic compound derived from microbial sources, specifically produced by Bacillus subtilis strains. It functions primarily by disrupting the cell membranes of pathogenic fungi, leading to altered membrane permeability and subsequent cell death. The unique structure of fengycin allows it to interact with membrane lipids, compromising membrane integrity and inhibiting fungal growth.</p>Fengycin
CAS:<p>Fengycin is a cyclic lipopeptide from Bacillus subtilis acts as a biosurfactant and antifungal. As a fungicide, it has a mode of action that involves the formation of ion channels in the fungal lipid membrane, leading to membrane leakage This activity is negatively correlated to cholesterol levels, and may explain why mammalian cells, with higher cholesterol present, are not sensitive to fengycin.</p>Formula:C72H110N12O20Purity:Min. 90 Area-%Color and Shape:PowderMolecular weight:1,463.71 g/mol

