CymitQuimica logo

CAS 102580-07-4

:

Phenol, 2-amino-4-(phenylmethoxy)-

Description:
Phenol, 2-amino-4-(phenylmethoxy)-, also known by its CAS number 102580-07-4, is an organic compound characterized by the presence of both an amino group and a phenoxy group attached to a phenolic structure. This compound typically exhibits properties associated with both phenols and amines, such as moderate solubility in polar solvents and potential reactivity due to the amino group. The phenylmethoxy substituent enhances its lipophilicity, which may influence its biological activity and interactions. The presence of the amino group can facilitate hydrogen bonding, potentially affecting its melting and boiling points. Additionally, this compound may exhibit antioxidant properties and could be of interest in pharmaceutical applications due to its structural features. Its synthesis and handling require standard laboratory safety precautions, as with many organic compounds, to mitigate any potential hazards associated with its reactivity and toxicity. Overall, the unique combination of functional groups in this compound contributes to its diverse chemical behavior and potential applications in various fields.
Formula:C13H13NO2
InChI:InChI=1S/C13H13NO2/c14-12-8-11(6-7-13(12)15)16-9-10-4-2-1-3-5-10/h1-8,15H,9,14H2
InChI key:STOOCDNLVDBYAP-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COC2=CC(=C(C=C2)O)N
Found 3 products.