CAS 102582-93-4
:4-(trifluoromethylthio)phenylacetic acid
Description:
4-(Trifluoromethylthio)phenylacetic acid is an organic compound characterized by the presence of a phenylacetic acid structure substituted with a trifluoromethylthio group. This compound features a phenyl ring attached to an acetic acid moiety, with the trifluoromethylthio group (-CF3S-) providing unique chemical properties. The trifluoromethyl group is known for its electron-withdrawing effects, which can influence the acidity and reactivity of the compound. The presence of sulfur in the thioether linkage contributes to its potential applications in medicinal chemistry and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical behavior can be affected by the trifluoromethylthio group, making it of interest for various synthetic applications and studies in drug development. Safety and handling precautions should be observed due to the presence of fluorinated and sulfur-containing moieties, which may pose environmental and health risks.
Formula:C9H7F3O2S
InChI:InChI=1/C9H7F3O2S/c10-9(11,12)15-7-3-1-6(2-4-7)5-8(13)14/h1-4H,5H2,(H,13,14)
SMILES:c1cc(ccc1CC(=O)O)SC(F)(F)F
Synonyms:- {4-[(Trifluoromethyl)Sulfanyl]Phenyl}Acetic Acid
- 4-(Trifluoromethylsulfanyl)phenylaceticacid
- Benzeneacetic acid,4-[(trifluoromethyl)thio]-
- 4-(Trifluoromethylthio)phenylaetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
{[4-(Trifluoromethyl)phenyl]thio}acetic acid
CAS:{[4-(Trifluoromethyl)phenyl]thio}acetic acidFormula:C9H7F3O2SPurity:97%Color and Shape:SolidMolecular weight:236.210882-((4-(Trifluoromethyl)phenyl)thio)acetic acid
CAS:Formula:C9H7F3O2SPurity:98%+;RGColor and Shape:SolidMolecular weight:236.2109{4-[(Trifluoromethyl)sulfanyl]phenyl}acetic acid
CAS:{4-[(Trifluoromethyl)sulfanyl]phenyl}acetic acid is a fine chemical that is useful in research, as an intermediate or a building block. It has been used in the preparation of complex compounds and as a reagent in organic synthesis. This compound can be used as a versatile building block to prepare various derivatives with different functional groups. {4-[(Trifluoromethyl)sulfanyl]phenyl}acetic acid is also a useful scaffold for the production of small-molecule drugs with antibiotic and anticancer activities.Formula:C9H7F3O2SPurity:Min. 95%Color and Shape:PowderMolecular weight:236.21 g/mol


