CymitQuimica logo

CAS 102596-84-9

:

2-[(dibenzylamino)methyl]cyclohexanone hydrochloride (1:1)

Description:
2-[(Dibenzylamino)methyl]cyclohexanone hydrochloride is a chemical compound characterized by its unique structure, which includes a cyclohexanone moiety substituted with a dibenzylamino group. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydrochloride salt form. The dibenzylamino group contributes to its potential biological activity, making it of interest in medicinal chemistry. The hydrochloride salt enhances its stability and solubility, which is advantageous for pharmaceutical applications. This compound may exhibit various properties, including potential analgesic or anesthetic effects, although specific biological activities would require further investigation. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with its use. Overall, 2-[(dibenzylamino)methyl]cyclohexanone hydrochloride represents a class of compounds that may have significant implications in drug development and therapeutic applications.
Formula:C21H26ClNO
InChI:InChI=1/C21H25NO.ClH/c23-21-14-8-7-13-20(21)17-22(15-18-9-3-1-4-10-18)16-19-11-5-2-6-12-19;/h1-6,9-12,20H,7-8,13-17H2;1H
InChI key:VTLHJZKKRMZUPQ-UHFFFAOYSA-N
SMILES:c1ccc(cc1)CN(Cc1ccccc1)CC1CCCCC1=O.Cl
Synonyms:
  • 2-((Dibenzylamino)methyl)cyclohexanone hydrochloride
Found 3 products.