CymitQuimica logo

CAS 1026-05-7

:

(2-METHYL-1,2,3,4-TETRAHYDRO-QUINOLIN-4-YL)-PHENYL-AMINE

Description:
(2-Methyl-1,2,3,4-tetrahydroquinolin-4-yl)phenylamine, with the CAS number 1026-05-7, is an organic compound characterized by its complex structure, which includes a tetrahydroquinoline moiety and a phenylamine group. This compound typically appears as a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of both a nitrogen atom in the tetrahydroquinoline ring and an amine group contributes to its basicity and potential reactivity, making it a candidate for various chemical reactions, including those involving electrophiles and nucleophiles. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its solubility and stability in different solvents. Additionally, the compound may exhibit biological activity, which warrants further investigation into its pharmacological properties. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C16H18N2
InChI:InChI=1S/C16H18N2/c1-12-11-16(18-13-7-3-2-4-8-13)14-9-5-6-10-15(14)17-12/h2-10,12,16-18H,11H2,1H3
InChI key:FTECJLOPKLYFII-UHFFFAOYSA-N
SMILES:CC1CC(C2=CC=CC=C2N1)NC3=CC=CC=C3
Synonyms:
  • Akos Bbs-00005674
  • Asischem N44996
  • N-(2-Methyl-1,2,3,4-Tetrahydro-4-Quinolinyl)-N-Phenylamine
Found 4 products.