CymitQuimica logo

CAS 102601-49-0

:

cholesteryl hemisuccinate tris

Description:
Cholesteryl hemisuccinate tris, with the CAS number 102601-49-0, is a derivative of cholesterol that features a hemisuccinate moiety, which is a half-ester of succinic acid. This compound is characterized by its amphiphilic nature, possessing both hydrophobic (cholesterol) and hydrophilic (hemisuccinate) properties, making it useful in various biochemical applications, particularly in drug delivery systems and membrane studies. Cholesteryl hemisuccinate tris can form liposomes or micelles, facilitating the encapsulation of hydrophilic drugs. Its structural characteristics contribute to its ability to interact with biological membranes, potentially altering membrane fluidity and permeability. Additionally, this compound may exhibit specific interactions with proteins and nucleic acids, influencing cellular processes. The synthesis of cholesteryl hemisuccinate tris typically involves esterification reactions, and its characterization can be performed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography. Overall, its unique properties make it a valuable compound in pharmaceutical and biotechnological research.
Formula:C31H50O4·C4H11NO3
InChI:InChI=1S/C31H50O4.C4H11NO3/c1-20(2)7-6-8-21(3)25-11-12-26-24-10-9-22-19-23(35-29(34)14-13-28(32)33)15-17-30(22,4)27(24)16-18-31(25,26)5;5-4(1-6,2-7)3-8/h9,20-21,23-27H,6-8,10-19H2,1-5H3,(H,32,33);6-8H,1-3,5H2/t21-,23+,24+,25-,26+,27+,30+,31-;/m1./s1
InChI key:SLDYONDUXRBLLR-XTCKSVDZSA-N
SMILES:C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)OC(=O)CCC(=O)O)C)C.C(C(CO)(CO)N)O
Found 6 products.