CymitQuimica logo

CAS 1026230-99-8

:

(2S)-2-Amino-2-(3-methylphenyl)ethanol

Description:
(2S)-2-Amino-2-(3-methylphenyl)ethanol, with the CAS number 1026230-99-8, is an organic compound characterized by its amino alcohol structure. It features a chiral center at the second carbon, which contributes to its stereochemistry, specifically the S configuration. The presence of the amino group (-NH2) and the hydroxyl group (-OH) makes it a bivalent compound, allowing it to participate in hydrogen bonding, which can influence its solubility in polar solvents. The 3-methylphenyl group attached to the second carbon provides hydrophobic characteristics, which can affect its interaction with biological systems and its overall reactivity. This compound may exhibit biological activity, potentially serving as a building block in pharmaceuticals or as a ligand in biochemical applications. Its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the presence of other functional groups in a given environment. Overall, (2S)-2-Amino-2-(3-methylphenyl)ethanol is a versatile compound with potential applications in medicinal chemistry and organic synthesis.
Formula:C9H13NO
InChI:InChI=1S/C9H13NO/c1-7-3-2-4-8(5-7)9(10)6-11/h2-5,9,11H,6,10H2,1H3/t9-/m1/s1
InChI key:RJJLTGSKFNJQCZ-SECBINFHSA-N
SMILES:CC1=CC(=CC=C1)[C@@H](CO)N
Found 4 products.