CAS 102630-80-8
:2-amino-N-(2,5-dimethylphenyl)benzamide
Description:
2-amino-N-(2,5-dimethylphenyl)benzamide, identified by its CAS number 102630-80-8, is an organic compound characterized by the presence of an amine group and a benzamide structure. This compound features a benzene ring substituted with an amino group (-NH2) and a benzamide moiety, which includes a carbonyl group (C=O) linked to a nitrogen atom. The presence of the 2,5-dimethylphenyl group indicates that there are two methyl groups attached to the phenyl ring at the 2 and 5 positions, contributing to its hydrophobic characteristics. The compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its aromatic nature. It may participate in hydrogen bonding due to the amino and carbonyl functional groups, influencing its reactivity and interactions in various chemical environments. Additionally, this compound may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific applications would depend on further research into its biological activity and chemical properties.
Formula:C15H16N2O
InChI:InChI=1/C15H16N2O/c1-10-7-8-11(2)14(9-10)17-15(18)12-5-3-4-6-13(12)16/h3-9H,16H2,1-2H3,(H,17,18)
InChI key:PFVFIDOVWVGKFZ-UHFFFAOYSA-N
SMILES:Cc1ccc(C)c(c1)N=C(c1ccccc1N)O
Synonyms:- benzamide, 2-amino-N-(2,5-dimethylphenyl)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
