CymitQuimica logo

CAS 102630-90-0

:

3-amino-N-(3,5-dimethylphenyl)benzamide

Description:
3-Amino-N-(3,5-dimethylphenyl)benzamide, with the CAS number 102630-90-0, is an organic compound characterized by its amine and amide functional groups. This compound features a benzamide structure, where a benzene ring is substituted with an amino group at the meta position and an N-(3,5-dimethylphenyl) group, indicating the presence of a dimethyl-substituted phenyl moiety. The presence of the amino group contributes to its potential as a building block in pharmaceuticals and agrochemicals, as it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The dimethyl substitutions on the phenyl ring can influence the compound's solubility, stability, and biological activity. Typically, compounds of this nature may exhibit moderate to high polarity, affecting their interactions in biological systems. Additionally, the structural features suggest potential applications in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. Overall, the characteristics of this compound make it a subject of interest in both synthetic and applied chemistry contexts.
Formula:C15H16N2O
InChI:InChI=1/C15H16N2O/c1-10-6-11(2)8-14(7-10)17-15(18)12-4-3-5-13(16)9-12/h3-9H,16H2,1-2H3,(H,17,18)
InChI key:YFZPKHBDGWIZMN-UHFFFAOYSA-N
SMILES:Cc1cc(C)cc(c1)N=C(c1cccc(c1)N)O
Synonyms:
  • benzamide, 3-amino-N-(3,5-dimethylphenyl)-
Found 2 products.